C31H33N3O6S — CID 173202804
N-(4-methylphenyl)sulfonyl-1-[(E)-3-[3-nitro-2-(2-propan-2-ylphenyl)phenyl]prop-2-enoyl]piperidine-4-carboxamide (PubChem CID 173202804) has the molecular formula C31H33N3O6S and a molecular weight of 575.69 g/mol. Its IUPAC name is N-(4-methylphenyl)sulfonyl-1-[(E)-3-[3-nitro-2-(2-propan-2-ylphenyl)phenyl]prop-2-enoyl]piperidine-4-carboxamide.
| Compound Name | N-(4-methylphenyl)sulfonyl-1-[(E)-3-[3-nitro-2-(2-propan-2-ylphenyl)phenyl]prop-2-enoyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 173202804 |
| Molecular Formula | C31H33N3O6S |
| Molecular Weight | 575.69 g/mol |
| Exact Mass | 575.21 |
| IUPAC Name | N-(4-methylphenyl)sulfonyl-1-[(E)-3-[3-nitro-2-(2-propan-2-ylphenyl)phenyl]prop-2-enoyl]piperidine-4-carboxamide |
| SMILES | Cc1ccc(S(=O)(=O)NC(=O)C2CCN(C(=O)/C=C/c3cccc([N+](=O)[O-])c3-c3ccccc3C(C)C)CC2)cc1 |
| InChI | InChI=1S/C31H33N3O6S/c1-21(2)26-8-4-5-9-27(26)30-23(7-6-10-28(30)34(37)38)13-16-29(35)33-19-17-24(18-20-33)31(36)32-41(39,40)25-14-11-22(3)12-15-25/h4-16,21,24H,17-20H2,1-3H3,(H,32,36)/b16-13+ |
| InChIKey | KZVDQZOTOGAHPQ-DTQAZKPQSA-N |
| XLogP | 5.45 |
| TPSA | 126.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.69 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|