C38H36Zr — CID 173203282
cyclohexylidenezirconium(2+);cyclopenta-1,3-diene;3,6-dibenzyl-1,9-dihydrofluoren-1-ide (PubChem CID 173203282) has the molecular formula C38H36Zr and a molecular weight of 583.93 g/mol. Its IUPAC name is cyclohexylidenezirconium(2+);cyclopenta-1,3-diene;3,6-dibenzyl-1,9-dihydrofluoren-1-ide.
| Compound Name | cyclohexylidenezirconium(2+);cyclopenta-1,3-diene;3,6-dibenzyl-1,9-dihydrofluoren-1-ide |
|---|---|
| PubChem CID | 173203282 |
| Molecular Formula | C38H36Zr |
| Molecular Weight | 583.93 g/mol |
| Exact Mass | 582.19 |
| IUPAC Name | cyclohexylidenezirconium(2+);cyclopenta-1,3-diene;3,6-dibenzyl-1,9-dihydrofluoren-1-ide |
| SMILES | [C-]1=CC=CC1.[Zr+2]=C1CCCCC1.[c-]1cc(Cc2ccccc2)cc2c1Cc1ccc(Cc3ccccc3)cc1-2 |
| InChI | InChI=1S/C27H21.C6H10.C5H5.Zr/c1-3-7-20(8-4-1)15-22-11-13-24-19-25-14-12-23(18-27(25)26(24)17-22)16-21-9-5-2-6-10-21;1-2-4-6-5-3-1;1-2-4-5-3-1;/h1-13,17-18H,15-16,19H2;1-5H2;1-3H,4H2;/q-1;;-1;+2 |
| InChIKey | ZYPGMPMUYKBFOR-UHFFFAOYSA-N |
| XLogP | 9.21 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.93 |
| LogP ≤ 5 | 9.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|