C36H32Zr — CID 173203326
cyclobutylidenezirconium(2+);cyclopenta-1,3-diene;3,6-dibenzyl-9H-fluoren-9-ide (PubChem CID 173203326) has the molecular formula C36H32Zr and a molecular weight of 555.88 g/mol. Its IUPAC name is cyclobutylidenezirconium(2+);cyclopenta-1,3-diene;3,6-dibenzyl-9H-fluoren-9-ide.
| Compound Name | cyclobutylidenezirconium(2+);cyclopenta-1,3-diene;3,6-dibenzyl-9H-fluoren-9-ide |
|---|---|
| PubChem CID | 173203326 |
| Molecular Formula | C36H32Zr |
| Molecular Weight | 555.88 g/mol |
| Exact Mass | 554.16 |
| IUPAC Name | cyclobutylidenezirconium(2+);cyclopenta-1,3-diene;3,6-dibenzyl-9H-fluoren-9-ide |
| SMILES | [C-]1=CC=CC1.[Zr+2]=C1CCC1.c1ccc(Cc2ccc3[cH-]c4ccc(Cc5ccccc5)cc4c3c2)cc1 |
| InChI | InChI=1S/C27H21.C5H5.C4H6.Zr/c1-3-7-20(8-4-1)15-22-11-13-24-19-25-14-12-23(18-27(25)26(24)17-22)16-21-9-5-2-6-10-21;1-2-4-5-3-1;1-2-4-3-1;/h1-14,17-19H,15-16H2;1-3H,4H2;1-3H2;/q2*-1;;+2 |
| InChIKey | DGYJIHHRPNFAPK-UHFFFAOYSA-N |
| XLogP | 9.09 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.88 |
| LogP ≤ 5 | 9.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|