About cyclopenta-1,3-diene;cyclopentylidenezirconium(2+);2,7-diphenyl-9H-fluoren-9-ide
cyclopenta-1,3-diene;cyclopentylidenezirconium(2+);2,7-diphenyl-9H-fluoren-9-ide (PubChem CID 173272622) has the molecular formula C35H30Zr
and a molecular weight of 541.85 g/mol. Its IUPAC name is cyclopenta-1,3-diene;cyclopentylidenezirconium(2+);2,7-diphenyl-9H-fluoren-9-ide.
Molecular Properties
| Compound Name | cyclopenta-1,3-diene;cyclopentylidenezirconium(2+);2,7-diphenyl-9H-fluoren-9-ide |
| PubChem CID | 173272622 |
| Molecular Formula | C35H30Zr |
| Molecular Weight | 541.85 g/mol |
| Exact Mass | 540.14 |
| IUPAC Name | cyclopenta-1,3-diene;cyclopentylidenezirconium(2+);2,7-diphenyl-9H-fluoren-9-ide |
| SMILES | [C-]1=CC=CC1.[Zr+2]=C1CCCC1.c1ccc(-c2ccc3c(c2)[cH-]c2cc(-c4ccccc4)ccc23)cc1 |
| InChI | InChI=1S/C25H17.C5H8.C5H5.Zr/c1-3-7-18(8-4-1)20-11-13-24-22(15-20)17-23-16-21(12-14-25(23)24)19-9-5-2-6-10-19;2*1-2-4-5-3-1;/h1-17H;1-4H2;1-3H,4H2;/q-1;;-1;+2 |
| InChIKey | FDZUIKKUNWWKDV-UHFFFAOYSA-N |
| XLogP | 9.63 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 541.85 |
| LogP ≤ 5 | 9.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze cyclopenta-1,3-diene;cyclopentylidenezirconium(2+);2,7-diphenyl-9H-fluoren-9-ide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclopenta-1,3-diene;cyclopentylidenezirconium(2+);2,7-diphenyl-9H-fluoren-9-ide?
The IUPAC name of cyclopenta-1,3-diene;cyclopentylidenezirconium(2+);2,7-diphenyl-9H-fluoren-9-ide (CID 173272622) is cyclopenta-1,3-diene;cyclopentylidenezirconium(2+);2,7-diphenyl-9H-fluoren-9-ide.
What is the SMILES notation for cyclopenta-1,3-diene;cyclopentylidenezirconium(2+);2,7-diphenyl-9H-fluoren-9-ide?
The canonical SMILES for cyclopenta-1,3-diene;cyclopentylidenezirconium(2+);2,7-diphenyl-9H-fluoren-9-ide is [C-]1=CC=CC1.[Zr+2]=C1CCCC1.c1ccc(-c2ccc3c(c2)[cH-]c2cc(-c4ccccc4)ccc23)cc1.
What is the InChIKey of cyclopenta-1,3-diene;cyclopentylidenezirconium(2+);2,7-diphenyl-9H-fluoren-9-ide?
The InChIKey is FDZUIKKUNWWKDV-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H17.C5H8.C5H5.Zr/c1-3-7-18(8-4-1)20-11-13-24-22(15-20)17-23-16-21(12-14-25(23)24)19-9-5-2-6-10-19;2*1-2-4-5-3-1;/h1-17H;1-4H2;1-3H,4H2;/q-1;;-1;+2.
What are the key properties of cyclopenta-1,3-diene;cyclopentylidenezirconium(2+);2,7-diphenyl-9H-fluoren-9-ide?
cyclopenta-1,3-diene;cyclopentylidenezirconium(2+);2,7-diphenyl-9H-fluoren-9-ide has a molecular weight of 541.85 g/mol, XLogP of 9.63, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopenta-1,3-diene;cyclopentylidenezirconium(2+);2,7-diphenyl-9H-fluoren-9-ide is sourced from PubChem (CID 173272622), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).