C22H20Zr — CID 158996763
1,1'-biphenyl;bis(cyclopenta-1,3-diene);zirconium(2+) (PubChem CID 158996763) has the molecular formula C22H20Zr and a molecular weight of 375.63 g/mol. Its IUPAC name is 1,1'-biphenyl;bis(cyclopenta-1,3-diene);zirconium(2+).
| Compound Name | 1,1'-biphenyl;bis(cyclopenta-1,3-diene);zirconium(2+) |
|---|---|
| PubChem CID | 158996763 |
| Molecular Formula | C22H20Zr |
| Molecular Weight | 375.63 g/mol |
| Exact Mass | 374.06 |
| IUPAC Name | 1,1'-biphenyl;bis(cyclopenta-1,3-diene);zirconium(2+) |
| SMILES | [C-]1=CC=CC1.[C-]1=CC=CC1.[Zr+2].c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C12H10.2C5H5.Zr/c1-3-7-11(8-4-1)12-9-5-2-6-10-12;2*1-2-4-5-3-1;/h1-10H;2*1-3H,4H2;/q;2*-1;+2 |
| InChIKey | UCIDSHILXYGDEP-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.63 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|