C11H10BrZr- — CID 174293313
bromobenzene;cyclopenta-1,3-diene;zirconium (PubChem CID 174293313) has the molecular formula C11H10BrZr- and a molecular weight of 313.33 g/mol. Its IUPAC name is bromobenzene;cyclopenta-1,3-diene;zirconium.
| Compound Name | bromobenzene;cyclopenta-1,3-diene;zirconium |
|---|---|
| PubChem CID | 174293313 |
| Molecular Formula | C11H10BrZr- |
| Molecular Weight | 313.33 g/mol |
| Exact Mass | 310.90 |
| IUPAC Name | bromobenzene;cyclopenta-1,3-diene;zirconium |
| SMILES | Brc1ccccc1.[C-]1=CC=CC1.[Zr] |
| InChI | InChI=1S/C6H5Br.C5H5.Zr/c7-6-4-2-1-3-5-6;1-2-4-5-3-1;/h1-5H;1-3H,4H2;/q;-1; |
| InChIKey | LDZMHINMIWROLH-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.33 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|