About bromobenzene;cyclopenta-1,3-diene;zirconium
bromobenzene;cyclopenta-1,3-diene;zirconium (PubChem CID 174293313) has the molecular formula C11H10BrZr-
and a molecular weight of 313.33 g/mol. Its IUPAC name is bromobenzene;cyclopenta-1,3-diene;zirconium.
Molecular Properties
| Compound Name | bromobenzene;cyclopenta-1,3-diene;zirconium |
| PubChem CID | 174293313 |
| Molecular Formula | C11H10BrZr- |
| Molecular Weight | 313.33 g/mol |
| Exact Mass | 310.90 |
| IUPAC Name | bromobenzene;cyclopenta-1,3-diene;zirconium |
| SMILES | Brc1ccccc1.[C-]1=CC=CC1.[Zr] |
| InChI | InChI=1S/C6H5Br.C5H5.Zr/c7-6-4-2-1-3-5-6;1-2-4-5-3-1;/h1-5H;1-3H,4H2;/q;-1; |
| InChIKey | LDZMHINMIWROLH-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.33 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze bromobenzene;cyclopenta-1,3-diene;zirconium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bromobenzene;cyclopenta-1,3-diene;zirconium?
The IUPAC name of bromobenzene;cyclopenta-1,3-diene;zirconium (CID 174293313) is bromobenzene;cyclopenta-1,3-diene;zirconium.
What is the SMILES notation for bromobenzene;cyclopenta-1,3-diene;zirconium?
The canonical SMILES for bromobenzene;cyclopenta-1,3-diene;zirconium is Brc1ccccc1.[C-]1=CC=CC1.[Zr].
What is the InChIKey of bromobenzene;cyclopenta-1,3-diene;zirconium?
The InChIKey is LDZMHINMIWROLH-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5Br.C5H5.Zr/c7-6-4-2-1-3-5-6;1-2-4-5-3-1;/h1-5H;1-3H,4H2;/q;-1;.
What are the key properties of bromobenzene;cyclopenta-1,3-diene;zirconium?
bromobenzene;cyclopenta-1,3-diene;zirconium has a molecular weight of 313.33 g/mol, XLogP of 3.75, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for bromobenzene;cyclopenta-1,3-diene;zirconium is sourced from PubChem (CID 174293313), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).