About benzene;cyclopenta-1,3-diene;manganese
benzene;cyclopenta-1,3-diene;manganese (PubChem CID 67644722) has the molecular formula C11H11Mn-
and a molecular weight of 198.15 g/mol. Its IUPAC name is benzene;cyclopenta-1,3-diene;manganese.
Molecular Properties
| Compound Name | benzene;cyclopenta-1,3-diene;manganese |
| PubChem CID | 67644722 |
| Molecular Formula | C11H11Mn- |
| Molecular Weight | 198.15 g/mol |
| Exact Mass | 198.02 |
| IUPAC Name | benzene;cyclopenta-1,3-diene;manganese |
| SMILES | [C-]1=CC=CC1.[Mn].c1ccccc1 |
| InChI | InChI=1S/C6H6.C5H5.Mn/c1-2-4-6-5-3-1;1-2-4-5-3-1;/h1-6H;1-3H,4H2;/q;-1; |
| InChIKey | WLNSPRCMADWIAF-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.15 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze benzene;cyclopenta-1,3-diene;manganese with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzene;cyclopenta-1,3-diene;manganese?
The IUPAC name of benzene;cyclopenta-1,3-diene;manganese (CID 67644722) is benzene;cyclopenta-1,3-diene;manganese.
What is the SMILES notation for benzene;cyclopenta-1,3-diene;manganese?
The canonical SMILES for benzene;cyclopenta-1,3-diene;manganese is [C-]1=CC=CC1.[Mn].c1ccccc1.
What is the InChIKey of benzene;cyclopenta-1,3-diene;manganese?
The InChIKey is WLNSPRCMADWIAF-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6.C5H5.Mn/c1-2-4-6-5-3-1;1-2-4-5-3-1;/h1-6H;1-3H,4H2;/q;-1;.
What are the key properties of benzene;cyclopenta-1,3-diene;manganese?
benzene;cyclopenta-1,3-diene;manganese has a molecular weight of 198.15 g/mol, XLogP of 2.99, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for benzene;cyclopenta-1,3-diene;manganese is sourced from PubChem (CID 67644722), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).