C14H24 — CID 173203365
3,3-ditert-butylcyclohexa-1,4-diene (PubChem CID 173203365) has the molecular formula C14H24 and a molecular weight of 192.35 g/mol. Its IUPAC name is 3,3-ditert-butylcyclohexa-1,4-diene.
| Compound Name | 3,3-ditert-butylcyclohexa-1,4-diene |
|---|---|
| PubChem CID | 173203365 |
| Molecular Formula | C14H24 |
| Molecular Weight | 192.35 g/mol |
| Exact Mass | 192.19 |
| IUPAC Name | 3,3-ditert-butylcyclohexa-1,4-diene |
| SMILES | CC(C)(C)C1(C(C)(C)C)C=CCC=C1 |
| InChI | InChI=1S/C14H24/c1-12(2,3)14(13(4,5)6)10-8-7-9-11-14/h8-11H,7H2,1-6H3 |
| InChIKey | SEDCPYKUCBHDRM-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.35 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|