C24H29N3O — CID 173204088
N-[(4-pent-1-ynylphenyl)methyl]-1-(pyridin-4-ylmethyl)piperidine-2-carboxamide (PubChem CID 173204088) has the molecular formula C24H29N3O and a molecular weight of 375.52 g/mol. Its IUPAC name is N-[(4-pent-1-ynylphenyl)methyl]-1-(pyridin-4-ylmethyl)piperidine-2-carboxamide.
| Compound Name | N-[(4-pent-1-ynylphenyl)methyl]-1-(pyridin-4-ylmethyl)piperidine-2-carboxamide |
|---|---|
| PubChem CID | 173204088 |
| Molecular Formula | C24H29N3O |
| Molecular Weight | 375.52 g/mol |
| Exact Mass | 375.23 |
| IUPAC Name | N-[(4-pent-1-ynylphenyl)methyl]-1-(pyridin-4-ylmethyl)piperidine-2-carboxamide |
| SMILES | CCCC#Cc1ccc(CNC(=O)C2CCCCN2Cc2ccncc2)cc1 |
| InChI | InChI=1S/C24H29N3O/c1-2-3-4-7-20-9-11-21(12-10-20)18-26-24(28)23-8-5-6-17-27(23)19-22-13-15-25-16-14-22/h9-16,23H,2-3,5-6,8,17-19H2,1H3,(H,26,28) |
| InChIKey | AFOILZOEZNHDJL-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.52 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|