About (2S)-N'-cyano-2-(2-methoxyphenyl)-N'-methylpentanediamide
(2S)-N'-cyano-2-(2-methoxyphenyl)-N'-methylpentanediamide (PubChem CID 173204733) has the molecular formula C14H17N3O3
and a molecular weight of 275.31 g/mol. Its IUPAC name is (2S)-N'-cyano-2-(2-methoxyphenyl)-N'-methylpentanediamide.
Molecular Properties
| Compound Name | (2S)-N'-cyano-2-(2-methoxyphenyl)-N'-methylpentanediamide |
| PubChem CID | 173204733 |
| Molecular Formula | C14H17N3O3 |
| Molecular Weight | 275.31 g/mol |
| Exact Mass | 275.13 |
| IUPAC Name | (2S)-N'-cyano-2-(2-methoxyphenyl)-N'-methylpentanediamide |
| SMILES | COc1ccccc1[C@H](CCC(=O)N(C)C#N)C(N)=O |
| InChI | InChI=1S/C14H17N3O3/c1-17(9-15)13(18)8-7-11(14(16)19)10-5-3-4-6-12(10)20-2/h3-6,11H,7-8H2,1-2H3,(H2,16,19)/t11-/m0/s1 |
| InChIKey | BPVKWTDFKDJMCC-NSHDSACASA-N |
| XLogP | 0.98 |
| TPSA | 96.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.31 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|
Analyze (2S)-N'-cyano-2-(2-methoxyphenyl)-N'-methylpentanediamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-N'-cyano-2-(2-methoxyphenyl)-N'-methylpentanediamide?
The IUPAC name of (2S)-N'-cyano-2-(2-methoxyphenyl)-N'-methylpentanediamide (CID 173204733) is (2S)-N'-cyano-2-(2-methoxyphenyl)-N'-methylpentanediamide.
What is the SMILES notation for (2S)-N'-cyano-2-(2-methoxyphenyl)-N'-methylpentanediamide?
The canonical SMILES for (2S)-N'-cyano-2-(2-methoxyphenyl)-N'-methylpentanediamide is COc1ccccc1[C@H](CCC(=O)N(C)C#N)C(N)=O.
What is the InChIKey of (2S)-N'-cyano-2-(2-methoxyphenyl)-N'-methylpentanediamide?
The InChIKey is BPVKWTDFKDJMCC-NSHDSACASA-N. The full InChI is InChI=1S/C14H17N3O3/c1-17(9-15)13(18)8-7-11(14(16)19)10-5-3-4-6-12(10)20-2/h3-6,11H,7-8H2,1-2H3,(H2,16,19)/t11-/m0/s1.
What are the key properties of (2S)-N'-cyano-2-(2-methoxyphenyl)-N'-methylpentanediamide?
(2S)-N'-cyano-2-(2-methoxyphenyl)-N'-methylpentanediamide has a molecular weight of 275.31 g/mol, XLogP of 0.98, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-N'-cyano-2-(2-methoxyphenyl)-N'-methylpentanediamide is sourced from PubChem (CID 173204733), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).