C21H26N2O3 — CID 66892971
2-(2-methoxyphenyl)-N'-phenyloctanediamide (PubChem CID 66892971) has the molecular formula C21H26N2O3 and a molecular weight of 354.45 g/mol. Its IUPAC name is 2-(2-methoxyphenyl)-N'-phenyloctanediamide.
| Compound Name | 2-(2-methoxyphenyl)-N'-phenyloctanediamide |
|---|---|
| PubChem CID | 66892971 |
| Molecular Formula | C21H26N2O3 |
| Molecular Weight | 354.45 g/mol |
| Exact Mass | 354.19 |
| IUPAC Name | 2-(2-methoxyphenyl)-N'-phenyloctanediamide |
| SMILES | COc1ccccc1C(CCCCCC(=O)Nc1ccccc1)C(N)=O |
| InChI | InChI=1S/C21H26N2O3/c1-26-19-14-9-8-12-17(19)18(21(22)25)13-6-3-7-15-20(24)23-16-10-4-2-5-11-16/h2,4-5,8-12,14,18H,3,6-7,13,15H2,1H3,(H2,22,25)(H,23,24) |
| InChIKey | CEHPGLBTZAPXFY-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.45 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|