C38H47N2O3+ — CID 173205849
6-[3,3-dimethyl-2-[3-[4-(2-methylpropyl)-3-oxa-13-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2(7),4,8-tetraen-6-ylidene]prop-1-enyl]indol-1-ium-1-yl]hexanoic acid (PubChem CID 173205849) has the molecular formula C38H47N2O3+ and a molecular weight of 579.81 g/mol. Its IUPAC name is 6-[3,3-dimethyl-2-[3-[4-(2-methylpropyl)-3-oxa-13-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2(7),4,8-tetraen-6-ylidene]prop-1-enyl]indol-1-ium-1-yl]hexanoic acid.
| Compound Name | 6-[3,3-dimethyl-2-[3-[4-(2-methylpropyl)-3-oxa-13-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2(7),4,8-tetraen-6-ylidene]prop-1-enyl]indol-1-ium-1-yl]hexanoic acid |
|---|---|
| PubChem CID | 173205849 |
| Molecular Formula | C38H47N2O3+ |
| Molecular Weight | 579.81 g/mol |
| Exact Mass | 579.36 |
| IUPAC Name | 6-[3,3-dimethyl-2-[3-[4-(2-methylpropyl)-3-oxa-13-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2(7),4,8-tetraen-6-ylidene]prop-1-enyl]indol-1-ium-1-yl]hexanoic acid |
| SMILES | CC(C)CC1=CC(=CC=CC2=[N+](CCCCCC(=O)O)c3ccccc3C2(C)C)c2cc3c4c(c2O1)CCCN4CCC3 |
| InChI | InChI=1S/C38H46N2O3/c1-26(2)23-29-24-27(31-25-28-14-11-20-39-21-12-15-30(36(28)39)37(31)43-29)13-10-18-34-38(3,4)32-16-7-8-17-33(32)40(34)22-9-5-6-19-35(41)42/h7-8,10,13,16-18,24-26H,5-6,9,11-12,14-15,19-23H2,1-4H3/p+1 |
| InChIKey | VZCBFRKSEIUGPE-UHFFFAOYSA-O |
| XLogP | 8.37 |
| TPSA | 52.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.81 |
| LogP ≤ 5 | 8.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|