C38H49N2O4S+ — CID 143494424
2-[(E,3E)-3-(4-tert-butyl-3-oxa-13-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2(7),4,8-tetraen-6-ylidene)prop-1-enyl]-1-hexyl-3,3-dimethylindol-1-ium-5-sulfonic acid (PubChem CID 143494424) has the molecular formula C38H49N2O4S+ and a molecular weight of 629.89 g/mol. Its IUPAC name is 2-[(E,3E)-3-(4-tert-butyl-3-oxa-13-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2(7),4,8-tetraen-6-ylidene)prop-1-enyl]-1-hexyl-3,3-dimethylindol-1-ium-5-sulfonic acid.
| Compound Name | 2-[(E,3E)-3-(4-tert-butyl-3-oxa-13-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2(7),4,8-tetraen-6-ylidene)prop-1-enyl]-1-hexyl-3,3-dimethylindol-1-ium-5-sulfonic acid |
|---|---|
| PubChem CID | 143494424 |
| Molecular Formula | C38H49N2O4S+ |
| Molecular Weight | 629.89 g/mol |
| Exact Mass | 629.34 |
| IUPAC Name | 2-[(E,3E)-3-(4-tert-butyl-3-oxa-13-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2(7),4,8-tetraen-6-ylidene)prop-1-enyl]-1-hexyl-3,3-dimethylindol-1-ium-5-sulfonic acid |
| SMILES | CCCCCC[N+]1=C(/C=C/C=C2\C=C(C(C)(C)C)Oc3c2cc2c4c3CCCN4CCC2)C(C)(C)c2cc(S(=O)(=O)O)ccc21 |
| InChI | InChI=1S/C38H48N2O4S/c1-7-8-9-10-22-40-32-19-18-28(45(41,42)43)25-31(32)38(5,6)33(40)17-11-14-26-24-34(37(2,3)4)44-36-29-16-13-21-39-20-12-15-27(35(29)39)23-30(26)36/h11,14,17-19,23-25H,7-10,12-13,15-16,20-22H2,1-6H3/p+1 |
| InChIKey | CFCILNNDSKGCPZ-UHFFFAOYSA-O |
| XLogP | 8.55 |
| TPSA | 69.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.89 |
| LogP ≤ 5 | 8.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|