azane;methyl 2,2-dimethyl-4-sulfanylbutanoate;hydrobromide

C7H18BrNO2S — CID 173206443

IUPACazane;methyl 2,2-dimethyl-4-sulfanylbutanoate;hydrobromide
SMILESBr.COC(=O)C(C)(C)CCS.N
InChIInChI=1S/C7H14O2S.BrH.H3N/c1-7(2,4-5-10)6(8)9-3;;/h10H,4-5H2,1-3H3;1H;1H3
InChIKeyVTIWBNZEUQVGIE-UHFFFAOYSA-N
MW260.20 g/mol
LogP2.25
Rot. Bonds3

About azane;methyl 2,2-dimethyl-4-sulfanylbutanoate;hydrobromide

azane;methyl 2,2-dimethyl-4-sulfanylbutanoate;hydrobromide (PubChem CID 173206443) has the molecular formula C7H18BrNO2S and a molecular weight of 260.20 g/mol. Its IUPAC name is azane;methyl 2,2-dimethyl-4-sulfanylbutanoate;hydrobromide.

Molecular Properties

Compound Nameazane;methyl 2,2-dimethyl-4-sulfanylbutanoate;hydrobromide
PubChem CID173206443
Molecular FormulaC7H18BrNO2S
Molecular Weight260.20 g/mol
Exact Mass259.02
IUPAC Nameazane;methyl 2,2-dimethyl-4-sulfanylbutanoate;hydrobromide
SMILESBr.COC(=O)C(C)(C)CCS.N
InChIInChI=1S/C7H14O2S.BrH.H3N/c1-7(2,4-5-10)6(8)9-3;;/h10H,4-5H2,1-3H3;1H;1H3
InChIKeyVTIWBNZEUQVGIE-UHFFFAOYSA-N
XLogP2.25
TPSA61.30 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms12
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500260.20
LogP ≤ 52.25
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'thiol_2', 'substructure': 'N/A'}

Analyze azane;methyl 2,2-dimethyl-4-sulfanylbutanoate;hydrobromide with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of azane;methyl 2,2-dimethyl-4-sulfanylbutanoate;hydrobromide?
The IUPAC name of azane;methyl 2,2-dimethyl-4-sulfanylbutanoate;hydrobromide (CID 173206443) is azane;methyl 2,2-dimethyl-4-sulfanylbutanoate;hydrobromide.
What is the SMILES notation for azane;methyl 2,2-dimethyl-4-sulfanylbutanoate;hydrobromide?
The canonical SMILES for azane;methyl 2,2-dimethyl-4-sulfanylbutanoate;hydrobromide is Br.COC(=O)C(C)(C)CCS.N.
What is the InChIKey of azane;methyl 2,2-dimethyl-4-sulfanylbutanoate;hydrobromide?
The InChIKey is VTIWBNZEUQVGIE-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14O2S.BrH.H3N/c1-7(2,4-5-10)6(8)9-3;;/h10H,4-5H2,1-3H3;1H;1H3.
What are the key properties of azane;methyl 2,2-dimethyl-4-sulfanylbutanoate;hydrobromide?
azane;methyl 2,2-dimethyl-4-sulfanylbutanoate;hydrobromide has a molecular weight of 260.20 g/mol, XLogP of 2.25, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for azane;methyl 2,2-dimethyl-4-sulfanylbutanoate;hydrobromide is sourced from PubChem (CID 173206443), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).