C34H52ClN3O5Si — CID 173206973
1-[(1R,2R,4S)-2-[4-[(4-chlorophenyl)methyl]piperidin-1-yl]-4-(1-dimethylsilyloxy-2,2-dimethylpropyl)cyclopentyl]-3-(3,4,5-trimethoxyphenyl)urea (PubChem CID 173206973) has the molecular formula C34H52ClN3O5Si and a molecular weight of 646.35 g/mol. Its IUPAC name is 1-[(1R,2R,4S)-2-[4-[(4-chlorophenyl)methyl]piperidin-1-yl]-4-(1-dimethylsilyloxy-2,2-dimethylpropyl)cyclopentyl]-3-(3,4,5-trimethoxyphenyl)urea.
| Compound Name | 1-[(1R,2R,4S)-2-[4-[(4-chlorophenyl)methyl]piperidin-1-yl]-4-(1-dimethylsilyloxy-2,2-dimethylpropyl)cyclopentyl]-3-(3,4,5-trimethoxyphenyl)urea |
|---|---|
| PubChem CID | 173206973 |
| Molecular Formula | C34H52ClN3O5Si |
| Molecular Weight | 646.35 g/mol |
| Exact Mass | 645.34 |
| IUPAC Name | 1-[(1R,2R,4S)-2-[4-[(4-chlorophenyl)methyl]piperidin-1-yl]-4-(1-dimethylsilyloxy-2,2-dimethylpropyl)cyclopentyl]-3-(3,4,5-trimethoxyphenyl)urea |
| SMILES | COc1cc(NC(=O)N[C@@H]2C[C@H](C(O[SiH](C)C)C(C)(C)C)C[C@H]2N2CCC(Cc3ccc(Cl)cc3)CC2)cc(OC)c1OC |
| InChI | InChI=1S/C34H52ClN3O5Si/c1-34(2,3)32(43-44(7)8)24-18-27(37-33(39)36-26-20-29(40-4)31(42-6)30(21-26)41-5)28(19-24)38-15-13-23(14-16-38)17-22-9-11-25(35)12-10-22/h9-12,20-21,23-24,27-28,32,44H,13-19H2,1-8H3,(H2,36,37,39)/t24-,27+,28+,32?/m0/s1 |
| InChIKey | DFQFEKWNSSCZRP-DMPVSRAVSA-N |
| XLogP | 7.00 |
| TPSA | 81.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.35 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|