C26H35ClN4O7S — CID 23587599
(3S,4S)-3-[4-[(4-chlorophenyl)methyl]piperidin-1-yl]-4-[(3,4,5-trimethoxyphenyl)carbamoylamino]pyrrolidine-1-sulfonic acid (PubChem CID 23587599) has the molecular formula C26H35ClN4O7S and a molecular weight of 583.11 g/mol. Its IUPAC name is (3S,4S)-3-[4-[(4-chlorophenyl)methyl]piperidin-1-yl]-4-[(3,4,5-trimethoxyphenyl)carbamoylamino]pyrrolidine-1-sulfonic acid.
| Compound Name | (3S,4S)-3-[4-[(4-chlorophenyl)methyl]piperidin-1-yl]-4-[(3,4,5-trimethoxyphenyl)carbamoylamino]pyrrolidine-1-sulfonic acid |
|---|---|
| PubChem CID | 23587599 |
| Molecular Formula | C26H35ClN4O7S |
| Molecular Weight | 583.11 g/mol |
| Exact Mass | 582.19 |
| IUPAC Name | (3S,4S)-3-[4-[(4-chlorophenyl)methyl]piperidin-1-yl]-4-[(3,4,5-trimethoxyphenyl)carbamoylamino]pyrrolidine-1-sulfonic acid |
| SMILES | COc1cc(NC(=O)N[C@H]2CN(S(=O)(=O)O)C[C@@H]2N2CCC(Cc3ccc(Cl)cc3)CC2)cc(OC)c1OC |
| InChI | InChI=1S/C26H35ClN4O7S/c1-36-23-13-20(14-24(37-2)25(23)38-3)28-26(32)29-21-15-31(39(33,34)35)16-22(21)30-10-8-18(9-11-30)12-17-4-6-19(27)7-5-17/h4-7,13-14,18,21-22H,8-12,15-16H2,1-3H3,(H2,28,29,32)(H,33,34,35)/t21-,22-/m0/s1 |
| InChIKey | XQEVJTVVSFEHQR-VXKWHMMOSA-N |
| XLogP | 3.30 |
| TPSA | 129.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.11 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|