C12H21Cl2OSiTi — CID 173207924
(2-cyclopenta-1,4-dien-1-yl-2-propoxyethyl)-dimethylsilane;titanium(3+);dichloride (PubChem CID 173207924) has the molecular formula C12H21Cl2OSiTi and a molecular weight of 328.16 g/mol. Its IUPAC name is (2-cyclopenta-1,4-dien-1-yl-2-propoxyethyl)-dimethylsilane;titanium(3+);dichloride.
| Compound Name | (2-cyclopenta-1,4-dien-1-yl-2-propoxyethyl)-dimethylsilane;titanium(3+);dichloride |
|---|---|
| PubChem CID | 173207924 |
| Molecular Formula | C12H21Cl2OSiTi |
| Molecular Weight | 328.16 g/mol |
| Exact Mass | 327.02 |
| IUPAC Name | (2-cyclopenta-1,4-dien-1-yl-2-propoxyethyl)-dimethylsilane;titanium(3+);dichloride |
| SMILES | CCCOC(C[SiH](C)C)C1=[C-]CC=C1.[Cl-].[Cl-].[Ti+3] |
| InChI | InChI=1S/C12H21OSi.2ClH.Ti/c1-4-9-13-12(10-14(2)3)11-7-5-6-8-11;;;/h5,7,12,14H,4,6,9-10H2,1-3H3;2*1H;/q-1;;;+3/p-2 |
| InChIKey | KILVICUEGSNQEB-UHFFFAOYSA-L |
| XLogP | -3.04 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.16 |
| LogP ≤ 5 | -3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|