C11H15NO — CID 173210401
5-piperidin-4-ylcyclohexa-2,4-dien-1-one (PubChem CID 173210401) has the molecular formula C11H15NO and a molecular weight of 177.25 g/mol. Its IUPAC name is 5-piperidin-4-ylcyclohexa-2,4-dien-1-one.
| Compound Name | 5-piperidin-4-ylcyclohexa-2,4-dien-1-one |
|---|---|
| PubChem CID | 173210401 |
| Molecular Formula | C11H15NO |
| Molecular Weight | 177.25 g/mol |
| Exact Mass | 177.12 |
| IUPAC Name | 5-piperidin-4-ylcyclohexa-2,4-dien-1-one |
| SMILES | O=C1C=CC=C(C2CCNCC2)C1 |
| InChI | InChI=1S/C11H15NO/c13-11-3-1-2-10(8-11)9-4-6-12-7-5-9/h1-3,9,12H,4-8H2 |
| InChIKey | UWNPRYPTTWVNBU-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.25 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |