About 1-fluorobut-3-enylsilane
1-fluorobut-3-enylsilane (PubChem CID 173211496) has the molecular formula C4H9FSi
and a molecular weight of 104.20 g/mol. Its IUPAC name is 1-fluorobut-3-enylsilane.
Molecular Properties
| Compound Name | 1-fluorobut-3-enylsilane |
| PubChem CID | 173211496 |
| Molecular Formula | C4H9FSi |
| Molecular Weight | 104.20 g/mol |
| Exact Mass | 104.05 |
| IUPAC Name | 1-fluorobut-3-enylsilane |
| SMILES | C=CCC(F)[SiH3] |
| InChI | InChI=1S/C4H9FSi/c1-2-3-4(5)6/h2,4H,1,3H2,6H3 |
| InChIKey | ZUWWYAWUZBQXQW-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 104.20 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-fluorobut-3-enylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-fluorobut-3-enylsilane?
The IUPAC name of 1-fluorobut-3-enylsilane (CID 173211496) is 1-fluorobut-3-enylsilane.
What is the SMILES notation for 1-fluorobut-3-enylsilane?
The canonical SMILES for 1-fluorobut-3-enylsilane is C=CCC(F)[SiH3].
What is the InChIKey of 1-fluorobut-3-enylsilane?
The InChIKey is ZUWWYAWUZBQXQW-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H9FSi/c1-2-3-4(5)6/h2,4H,1,3H2,6H3.
What are the key properties of 1-fluorobut-3-enylsilane?
1-fluorobut-3-enylsilane has a molecular weight of 104.20 g/mol, XLogP of 0.22, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-fluorobut-3-enylsilane is sourced from PubChem (CID 173211496), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).