C17H34NNaO2 — CID 173211622
sodium;hydride;(2S)-4-methyl-2-(undecylideneamino)pentanoic acid (PubChem CID 173211622) has the molecular formula C17H34NNaO2 and a molecular weight of 307.45 g/mol. Its IUPAC name is sodium;hydride;(2S)-4-methyl-2-(undecylideneamino)pentanoic acid.
| Compound Name | sodium;hydride;(2S)-4-methyl-2-(undecylideneamino)pentanoic acid |
|---|---|
| PubChem CID | 173211622 |
| Molecular Formula | C17H34NNaO2 |
| Molecular Weight | 307.45 g/mol |
| Exact Mass | 307.25 |
| IUPAC Name | sodium;hydride;(2S)-4-methyl-2-(undecylideneamino)pentanoic acid |
| SMILES | CCCCCCCCCC/C=N/[C@@H](CC(C)C)C(=O)O.[H-].[Na+] |
| InChI | InChI=1S/C17H33NO2.Na.H/c1-4-5-6-7-8-9-10-11-12-13-18-16(17(19)20)14-15(2)3;;/h13,15-16H,4-12,14H2,1-3H3,(H,19,20);;/q;+1;-1/b18-13+;;/t16-;;/m0../s1 |
| InChIKey | JEFQFOBCFJOGRZ-NCFXOZOFSA-N |
| XLogP | 2.20 |
| TPSA | 49.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.45 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|