C17H33NO2 — CID 87991654
(2S)-4-methyl-2-(undecylideneamino)pentanoic acid (PubChem CID 87991654) has the molecular formula C17H33NO2 and a molecular weight of 283.46 g/mol. Its IUPAC name is (2S)-4-methyl-2-(undecylideneamino)pentanoic acid.
| Compound Name | (2S)-4-methyl-2-(undecylideneamino)pentanoic acid |
|---|---|
| PubChem CID | 87991654 |
| Molecular Formula | C17H33NO2 |
| Molecular Weight | 283.46 g/mol |
| Exact Mass | 283.25 |
| IUPAC Name | (2S)-4-methyl-2-(undecylideneamino)pentanoic acid |
| SMILES | CCCCCCCCCC/C=N/[C@@H](CC(C)C)C(=O)O |
| InChI | InChI=1S/C17H33NO2/c1-4-5-6-7-8-9-10-11-12-13-18-16(17(19)20)14-15(2)3/h13,15-16H,4-12,14H2,1-3H3,(H,19,20)/b18-13+/t16-/m0/s1 |
| InChIKey | JXUWVUMDIIJBOV-HZGBGQKMSA-N |
| XLogP | 5.09 |
| TPSA | 49.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.46 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|