C21H23N3O3S — CID 17321306
N-[5-[2-(4-methoxyphenyl)ethyl]-1,3,4-thiadiazol-2-yl]-2-phenoxybutanamide (PubChem CID 17321306) has the molecular formula C21H23N3O3S and a molecular weight of 397.50 g/mol. Its IUPAC name is N-[5-[2-(4-methoxyphenyl)ethyl]-1,3,4-thiadiazol-2-yl]-2-phenoxybutanamide.
| Compound Name | N-[5-[2-(4-methoxyphenyl)ethyl]-1,3,4-thiadiazol-2-yl]-2-phenoxybutanamide |
|---|---|
| PubChem CID | 17321306 |
| Molecular Formula | C21H23N3O3S |
| Molecular Weight | 397.50 g/mol |
| Exact Mass | 397.15 |
| IUPAC Name | N-[5-[2-(4-methoxyphenyl)ethyl]-1,3,4-thiadiazol-2-yl]-2-phenoxybutanamide |
| SMILES | CCC(Oc1ccccc1)C(=O)Nc1nnc(CCc2ccc(OC)cc2)s1 |
| InChI | InChI=1S/C21H23N3O3S/c1-3-18(27-17-7-5-4-6-8-17)20(25)22-21-24-23-19(28-21)14-11-15-9-12-16(26-2)13-10-15/h4-10,12-13,18H,3,11,14H2,1-2H3,(H,22,24,25) |
| InChIKey | CLXWGRVKYGQYQL-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.50 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |