C12H18N2O — CID 173213251
2-[(pentylhydrazinylidene)methyl]phenol (PubChem CID 173213251) has the molecular formula C12H18N2O and a molecular weight of 206.29 g/mol. Its IUPAC name is 2-[(pentylhydrazinylidene)methyl]phenol.
| Compound Name | 2-[(pentylhydrazinylidene)methyl]phenol |
|---|---|
| PubChem CID | 173213251 |
| Molecular Formula | C12H18N2O |
| Molecular Weight | 206.29 g/mol |
| Exact Mass | 206.14 |
| IUPAC Name | 2-[(pentylhydrazinylidene)methyl]phenol |
| SMILES | CCCCCNN=Cc1ccccc1O |
| InChI | InChI=1S/C12H18N2O/c1-2-3-6-9-13-14-10-11-7-4-5-8-12(11)15/h4-5,7-8,10,13,15H,2-3,6,9H2,1H3 |
| InChIKey | AZUNEOJYVGEAES-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 44.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.29 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|