C7H15Cl3OSi — CID 173215496
pentylsilane;2,2,2-trichloroacetaldehyde (PubChem CID 173215496) has the molecular formula C7H15Cl3OSi and a molecular weight of 249.64 g/mol. Its IUPAC name is pentylsilane;2,2,2-trichloroacetaldehyde.
| Compound Name | pentylsilane;2,2,2-trichloroacetaldehyde |
|---|---|
| PubChem CID | 173215496 |
| Molecular Formula | C7H15Cl3OSi |
| Molecular Weight | 249.64 g/mol |
| Exact Mass | 248.00 |
| IUPAC Name | pentylsilane;2,2,2-trichloroacetaldehyde |
| SMILES | CCCCC[SiH3].O=CC(Cl)(Cl)Cl |
| InChI | InChI=1S/C5H14Si.C2HCl3O/c1-2-3-4-5-6;3-2(4,5)1-6/h2-5H2,1,6H3;1H |
| InChIKey | VPFCIRUPCJJKPV-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.64 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|