About dichloromethane;hexane;tetrachloromethane
dichloromethane;hexane;tetrachloromethane (PubChem CID 88500059) has the molecular formula C8H16Cl6
and a molecular weight of 324.93 g/mol. Its IUPAC name is dichloromethane;hexane;tetrachloromethane.
Molecular Properties
| Compound Name | dichloromethane;hexane;tetrachloromethane |
| PubChem CID | 88500059 |
| Molecular Formula | C8H16Cl6 |
| Molecular Weight | 324.93 g/mol |
| Exact Mass | 321.94 |
| IUPAC Name | dichloromethane;hexane;tetrachloromethane |
| SMILES | CCCCCC.ClC(Cl)(Cl)Cl.ClCCl |
| InChI | InChI=1S/C6H14.CCl4.CH2Cl2/c1-3-5-6-4-2;2-1(3,4)5;2-1-3/h3-6H2,1-2H3;;1H2 |
| InChIKey | YIOVYSYSJICQGH-UHFFFAOYSA-N |
| XLogP | 6.56 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 324.93 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze dichloromethane;hexane;tetrachloromethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dichloromethane;hexane;tetrachloromethane?
The IUPAC name of dichloromethane;hexane;tetrachloromethane (CID 88500059) is dichloromethane;hexane;tetrachloromethane.
What is the SMILES notation for dichloromethane;hexane;tetrachloromethane?
The canonical SMILES for dichloromethane;hexane;tetrachloromethane is CCCCCC.ClC(Cl)(Cl)Cl.ClCCl.
What is the InChIKey of dichloromethane;hexane;tetrachloromethane?
The InChIKey is YIOVYSYSJICQGH-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H14.CCl4.CH2Cl2/c1-3-5-6-4-2;2-1(3,4)5;2-1-3/h3-6H2,1-2H3;;1H2.
What are the key properties of dichloromethane;hexane;tetrachloromethane?
dichloromethane;hexane;tetrachloromethane has a molecular weight of 324.93 g/mol, XLogP of 6.56, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for dichloromethane;hexane;tetrachloromethane is sourced from PubChem (CID 88500059), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).