C22H29F17O4S2 — CID 173216513
4-butyl-2,2-dimethyl-4-sulfanyloctan-3-one;1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctane-1-sulfonic acid (PubChem CID 173216513) has the molecular formula C22H29F17O4S2 and a molecular weight of 744.57 g/mol. Its IUPAC name is 4-butyl-2,2-dimethyl-4-sulfanyloctan-3-one;1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctane-1-sulfonic acid.
| Compound Name | 4-butyl-2,2-dimethyl-4-sulfanyloctan-3-one;1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctane-1-sulfonic acid |
|---|---|
| PubChem CID | 173216513 |
| Molecular Formula | C22H29F17O4S2 |
| Molecular Weight | 744.57 g/mol |
| Exact Mass | 744.12 |
| IUPAC Name | 4-butyl-2,2-dimethyl-4-sulfanyloctan-3-one;1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctane-1-sulfonic acid |
| SMILES | CCCCC(S)(CCCC)C(=O)C(C)(C)C.O=S(=O)(O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C14H28OS.C8HF17O3S/c1-6-8-10-14(16,11-9-7-2)12(15)13(3,4)5;9-1(10,3(13,14)5(17,18)7(21,22)23)2(11,12)4(15,16)6(19,20)8(24,25)29(26,27)28/h16H,6-11H2,1-5H3;(H,26,27,28) |
| InChIKey | GPQYBRHCIZABDP-UHFFFAOYSA-N |
| XLogP | 9.49 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 744.57 |
| LogP ≤ 5 | 9.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|