C21H21N3O8S — CID 173218420
methyl 3-[[4-[5-(methylsulfonyloxymethyl)-2-oxo-1,3-oxazolidin-3-yl]benzenecarboximidoyl]carbamoyl]benzoate (PubChem CID 173218420) has the molecular formula C21H21N3O8S and a molecular weight of 475.48 g/mol. Its IUPAC name is methyl 3-[[4-[5-(methylsulfonyloxymethyl)-2-oxo-1,3-oxazolidin-3-yl]benzenecarboximidoyl]carbamoyl]benzoate.
| Compound Name | methyl 3-[[4-[5-(methylsulfonyloxymethyl)-2-oxo-1,3-oxazolidin-3-yl]benzenecarboximidoyl]carbamoyl]benzoate |
|---|---|
| PubChem CID | 173218420 |
| Molecular Formula | C21H21N3O8S |
| Molecular Weight | 475.48 g/mol |
| Exact Mass | 475.10 |
| IUPAC Name | methyl 3-[[4-[5-(methylsulfonyloxymethyl)-2-oxo-1,3-oxazolidin-3-yl]benzenecarboximidoyl]carbamoyl]benzoate |
| SMILES | [H]/N=C(\NC(=O)c1cccc(C(=O)OC)c1)c1ccc(N2CC(COS(C)(=O)=O)OC2=O)cc1 |
| InChI | InChI=1S/C21H21N3O8S/c1-30-20(26)15-5-3-4-14(10-15)19(25)23-18(22)13-6-8-16(9-7-13)24-11-17(32-21(24)27)12-31-33(2,28)29/h3-10,17H,11-12H2,1-2H3,(H2,22,23,25) |
| InChIKey | DMEHGWUQHJEWLO-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 152.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.48 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|