C13H23N — CID 173219233
3-(4-ethylcyclohexyl)-N,N-dimethylprop-2-yn-1-amine (PubChem CID 173219233) has the molecular formula C13H23N and a molecular weight of 193.33 g/mol. Its IUPAC name is 3-(4-ethylcyclohexyl)-N,N-dimethylprop-2-yn-1-amine.
| Compound Name | 3-(4-ethylcyclohexyl)-N,N-dimethylprop-2-yn-1-amine |
|---|---|
| PubChem CID | 173219233 |
| Molecular Formula | C13H23N |
| Molecular Weight | 193.33 g/mol |
| Exact Mass | 193.18 |
| IUPAC Name | 3-(4-ethylcyclohexyl)-N,N-dimethylprop-2-yn-1-amine |
| SMILES | CCC1CCC(C#CCN(C)C)CC1 |
| InChI | InChI=1S/C13H23N/c1-4-12-7-9-13(10-8-12)6-5-11-14(2)3/h12-13H,4,7-11H2,1-3H3 |
| InChIKey | AJDVWAMKPZTQAG-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.33 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|