C18H24N4 — CID 22236362
6-[[4-[3-(dimethylamino)prop-1-ynyl]cyclohexyl]-methylamino]pyridine-3-carbonitrile (PubChem CID 22236362) has the molecular formula C18H24N4 and a molecular weight of 296.42 g/mol. Its IUPAC name is 6-[[4-[3-(dimethylamino)prop-1-ynyl]cyclohexyl]-methylamino]pyridine-3-carbonitrile.
| Compound Name | 6-[[4-[3-(dimethylamino)prop-1-ynyl]cyclohexyl]-methylamino]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 22236362 |
| Molecular Formula | C18H24N4 |
| Molecular Weight | 296.42 g/mol |
| Exact Mass | 296.20 |
| IUPAC Name | 6-[[4-[3-(dimethylamino)prop-1-ynyl]cyclohexyl]-methylamino]pyridine-3-carbonitrile |
| SMILES | CN(C)CC#CC1CCC(N(C)c2ccc(C#N)cn2)CC1 |
| InChI | InChI=1S/C18H24N4/c1-21(2)12-4-5-15-6-9-17(10-7-15)22(3)18-11-8-16(13-19)14-20-18/h8,11,14-15,17H,6-7,9-10,12H2,1-3H3 |
| InChIKey | NWZUJJJRVMFUTO-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 43.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.42 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|