C12H20F2N2 — CID 173219357
N-(1,4-difluorocyclohexa-2,4-dien-1-yl)-N',N'-diethylethane-1,2-diamine (PubChem CID 173219357) has the molecular formula C12H20F2N2 and a molecular weight of 230.30 g/mol. Its IUPAC name is N-(1,4-difluorocyclohexa-2,4-dien-1-yl)-N',N'-diethylethane-1,2-diamine.
| Compound Name | N-(1,4-difluorocyclohexa-2,4-dien-1-yl)-N',N'-diethylethane-1,2-diamine |
|---|---|
| PubChem CID | 173219357 |
| Molecular Formula | C12H20F2N2 |
| Molecular Weight | 230.30 g/mol |
| Exact Mass | 230.16 |
| IUPAC Name | N-(1,4-difluorocyclohexa-2,4-dien-1-yl)-N',N'-diethylethane-1,2-diamine |
| SMILES | CCN(CC)CCNC1(F)C=CC(F)=CC1 |
| InChI | InChI=1S/C12H20F2N2/c1-3-16(4-2)10-9-15-12(14)7-5-11(13)6-8-12/h5-7,15H,3-4,8-10H2,1-2H3 |
| InChIKey | NOOZTZZCLAAPGP-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.30 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|