C11H17F3N2 — CID 142862529
1-[(2Z,4E)-7,7,7-trifluorohepta-2,4-dien-4-yl]piperazine (PubChem CID 142862529) has the molecular formula C11H17F3N2 and a molecular weight of 234.26 g/mol. Its IUPAC name is 1-[(2Z,4E)-7,7,7-trifluorohepta-2,4-dien-4-yl]piperazine.
| Compound Name | 1-[(2Z,4E)-7,7,7-trifluorohepta-2,4-dien-4-yl]piperazine |
|---|---|
| PubChem CID | 142862529 |
| Molecular Formula | C11H17F3N2 |
| Molecular Weight | 234.26 g/mol |
| Exact Mass | 234.13 |
| IUPAC Name | 1-[(2Z,4E)-7,7,7-trifluorohepta-2,4-dien-4-yl]piperazine |
| SMILES | C/C=C\C(=C/CC(F)(F)F)N1CCNCC1 |
| InChI | InChI=1S/C11H17F3N2/c1-2-3-10(4-5-11(12,13)14)16-8-6-15-7-9-16/h2-4,15H,5-9H2,1H3/b3-2-,10-4+ |
| InChIKey | ZUPTYTZDZSTVPK-RVQAKMSSSA-N |
| XLogP | 2.30 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.26 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|