C13H23FN2 — CID 123142512
1-(2-fluoronona-3,6-dien-5-yl)piperazine (PubChem CID 123142512) has the molecular formula C13H23FN2 and a molecular weight of 226.34 g/mol. Its IUPAC name is 1-(2-fluoronona-3,6-dien-5-yl)piperazine.
| Compound Name | 1-(2-fluoronona-3,6-dien-5-yl)piperazine |
|---|---|
| PubChem CID | 123142512 |
| Molecular Formula | C13H23FN2 |
| Molecular Weight | 226.34 g/mol |
| Exact Mass | 226.18 |
| IUPAC Name | 1-(2-fluoronona-3,6-dien-5-yl)piperazine |
| SMILES | CCC=CC(C=CC(C)F)N1CCNCC1 |
| InChI | InChI=1S/C13H23FN2/c1-3-4-5-13(7-6-12(2)14)16-10-8-15-9-11-16/h4-7,12-13,15H,3,8-11H2,1-2H3 |
| InChIKey | YITXPRFGYGKGBW-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.34 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|