C11H15FN2 — CID 142112896
1-(2-fluorocyclohepta-2,4,6-trien-1-yl)piperazine (PubChem CID 142112896) has the molecular formula C11H15FN2 and a molecular weight of 194.25 g/mol. Its IUPAC name is 1-(2-fluorocyclohepta-2,4,6-trien-1-yl)piperazine.
| Compound Name | 1-(2-fluorocyclohepta-2,4,6-trien-1-yl)piperazine |
|---|---|
| PubChem CID | 142112896 |
| Molecular Formula | C11H15FN2 |
| Molecular Weight | 194.25 g/mol |
| Exact Mass | 194.12 |
| IUPAC Name | 1-(2-fluorocyclohepta-2,4,6-trien-1-yl)piperazine |
| SMILES | FC1=CC=CC=CC1N1CCNCC1 |
| InChI | InChI=1S/C11H15FN2/c12-10-4-2-1-3-5-11(10)14-8-6-13-7-9-14/h1-5,11,13H,6-9H2 |
| InChIKey | DJFLESRGOGVYSI-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.25 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |