C10H15FN2 — CID 144829719
2-(2-fluorocyclohexa-1,5-dien-1-yl)piperazine (PubChem CID 144829719) has the molecular formula C10H15FN2 and a molecular weight of 182.24 g/mol. Its IUPAC name is 2-(2-fluorocyclohexa-1,5-dien-1-yl)piperazine.
| Compound Name | 2-(2-fluorocyclohexa-1,5-dien-1-yl)piperazine |
|---|---|
| PubChem CID | 144829719 |
| Molecular Formula | C10H15FN2 |
| Molecular Weight | 182.24 g/mol |
| Exact Mass | 182.12 |
| IUPAC Name | 2-(2-fluorocyclohexa-1,5-dien-1-yl)piperazine |
| SMILES | FC1=C(C2CNCCN2)C=CCC1 |
| InChI | InChI=1S/C10H15FN2/c11-9-4-2-1-3-8(9)10-7-12-5-6-13-10/h1,3,10,12-13H,2,4-7H2 |
| InChIKey | KVBOISQUJZKITD-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.24 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |