C25H36FN5O8S2 — CID 173219482
2-[2-ethoxy-5-[4-(3-fluoropropyl)piperazin-1-yl]sulfonylphenyl]-5-methyl-7-propyl-3H-pyrrolo[3,2-d]pyrimidin-4-one;hydrogen sulfate;hydron (PubChem CID 173219482) has the molecular formula C25H36FN5O8S2 and a molecular weight of 617.72 g/mol. Its IUPAC name is 2-[2-ethoxy-5-[4-(3-fluoropropyl)piperazin-1-yl]sulfonylphenyl]-5-methyl-7-propyl-3H-pyrrolo[3,2-d]pyrimidin-4-one;hydrogen sulfate;hydron.
| Compound Name | 2-[2-ethoxy-5-[4-(3-fluoropropyl)piperazin-1-yl]sulfonylphenyl]-5-methyl-7-propyl-3H-pyrrolo[3,2-d]pyrimidin-4-one;hydrogen sulfate;hydron |
|---|---|
| PubChem CID | 173219482 |
| Molecular Formula | C25H36FN5O8S2 |
| Molecular Weight | 617.72 g/mol |
| Exact Mass | 617.20 |
| IUPAC Name | 2-[2-ethoxy-5-[4-(3-fluoropropyl)piperazin-1-yl]sulfonylphenyl]-5-methyl-7-propyl-3H-pyrrolo[3,2-d]pyrimidin-4-one;hydrogen sulfate;hydron |
| SMILES | CCCc1cn(C)c2c(=O)[nH]c(-c3cc(S(=O)(=O)N4CCN(CCCF)CC4)ccc3OCC)nc12.O=S(=O)([O-])O.[H+] |
| InChI | InChI=1S/C25H34FN5O4S.H2O4S/c1-4-7-18-17-29(3)23-22(18)27-24(28-25(23)32)20-16-19(8-9-21(20)35-5-2)36(33,34)31-14-12-30(13-15-31)11-6-10-26;1-5(2,3)4/h8-9,16-17H,4-7,10-15H2,1-3H3,(H,27,28,32);(H2,1,2,3,4) |
| InChIKey | DJWHXUQDDBRATO-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 177.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.72 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|