About N,N-dimethyltetradec-1-en-1-amine;propane
N,N-dimethyltetradec-1-en-1-amine;propane (PubChem CID 173220262) has the molecular formula C19H41N
and a molecular weight of 283.54 g/mol. Its IUPAC name is N,N-dimethyltetradec-1-en-1-amine;propane.
Molecular Properties
| Compound Name | N,N-dimethyltetradec-1-en-1-amine;propane |
| PubChem CID | 173220262 |
| Molecular Formula | C19H41N |
| Molecular Weight | 283.54 g/mol |
| Exact Mass | 283.32 |
| IUPAC Name | N,N-dimethyltetradec-1-en-1-amine;propane |
| SMILES | CCC.CCCCCCCCCCCCC=CN(C)C |
| InChI | InChI=1S/C16H33N.C3H8/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17(2)3;1-3-2/h15-16H,4-14H2,1-3H3;3H2,1-2H3 |
| InChIKey | NJUINUXRFPTJFM-UHFFFAOYSA-N |
| XLogP | 6.79 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 283.54 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N,N-dimethyltetradec-1-en-1-amine;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dimethyltetradec-1-en-1-amine;propane?
The IUPAC name of N,N-dimethyltetradec-1-en-1-amine;propane (CID 173220262) is N,N-dimethyltetradec-1-en-1-amine;propane.
What is the SMILES notation for N,N-dimethyltetradec-1-en-1-amine;propane?
The canonical SMILES for N,N-dimethyltetradec-1-en-1-amine;propane is CCC.CCCCCCCCCCCCC=CN(C)C.
What is the InChIKey of N,N-dimethyltetradec-1-en-1-amine;propane?
The InChIKey is NJUINUXRFPTJFM-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H33N.C3H8/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17(2)3;1-3-2/h15-16H,4-14H2,1-3H3;3H2,1-2H3.
What are the key properties of N,N-dimethyltetradec-1-en-1-amine;propane?
N,N-dimethyltetradec-1-en-1-amine;propane has a molecular weight of 283.54 g/mol, XLogP of 6.79, 12 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dimethyltetradec-1-en-1-amine;propane is sourced from PubChem (CID 173220262), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).