C12H24N2 — CID 141423827
(1E,7E)-N,N,N',N'-tetramethylocta-1,7-diene-1,8-diamine (PubChem CID 141423827) has the molecular formula C12H24N2 and a molecular weight of 196.34 g/mol. Its IUPAC name is (1E,7E)-N,N,N',N'-tetramethylocta-1,7-diene-1,8-diamine.
| Compound Name | (1E,7E)-N,N,N',N'-tetramethylocta-1,7-diene-1,8-diamine |
|---|---|
| PubChem CID | 141423827 |
| Molecular Formula | C12H24N2 |
| Molecular Weight | 196.34 g/mol |
| Exact Mass | 196.19 |
| IUPAC Name | (1E,7E)-N,N,N',N'-tetramethylocta-1,7-diene-1,8-diamine |
| SMILES | CN(C)/C=C/CCCC/C=C/N(C)C |
| InChI | InChI=1S/C12H24N2/c1-13(2)11-9-7-5-6-8-10-12-14(3)4/h9-12H,5-8H2,1-4H3/b11-9+,12-10+ |
| InChIKey | CNNGZVLCNKEJGH-WGDLNXRISA-N |
| XLogP | 2.70 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.34 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|