About ethane;(Z)-3-methoxy-N,N-dimethylprop-1-en-1-amine
ethane;(Z)-3-methoxy-N,N-dimethylprop-1-en-1-amine (PubChem CID 143551220) has the molecular formula C8H19NO
and a molecular weight of 145.25 g/mol. Its IUPAC name is ethane;(Z)-3-methoxy-N,N-dimethylprop-1-en-1-amine.
Molecular Properties
| Compound Name | ethane;(Z)-3-methoxy-N,N-dimethylprop-1-en-1-amine |
| PubChem CID | 143551220 |
| Molecular Formula | C8H19NO |
| Molecular Weight | 145.25 g/mol |
| Exact Mass | 145.15 |
| IUPAC Name | ethane;(Z)-3-methoxy-N,N-dimethylprop-1-en-1-amine |
| SMILES | CC.COC/C=C\N(C)C |
| InChI | InChI=1S/C6H13NO.C2H6/c1-7(2)5-4-6-8-3;1-2/h4-5H,6H2,1-3H3;1-2H3/b5-4-; |
| InChIKey | INDUSKMWJCPWBS-MKWAYWHRSA-N |
| XLogP | 1.73 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 145.25 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethane;(Z)-3-methoxy-N,N-dimethylprop-1-en-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;(Z)-3-methoxy-N,N-dimethylprop-1-en-1-amine?
The IUPAC name of ethane;(Z)-3-methoxy-N,N-dimethylprop-1-en-1-amine (CID 143551220) is ethane;(Z)-3-methoxy-N,N-dimethylprop-1-en-1-amine.
What is the SMILES notation for ethane;(Z)-3-methoxy-N,N-dimethylprop-1-en-1-amine?
The canonical SMILES for ethane;(Z)-3-methoxy-N,N-dimethylprop-1-en-1-amine is CC.COC/C=C\N(C)C.
What is the InChIKey of ethane;(Z)-3-methoxy-N,N-dimethylprop-1-en-1-amine?
The InChIKey is INDUSKMWJCPWBS-MKWAYWHRSA-N. The full InChI is InChI=1S/C6H13NO.C2H6/c1-7(2)5-4-6-8-3;1-2/h4-5H,6H2,1-3H3;1-2H3/b5-4-;.
What are the key properties of ethane;(Z)-3-methoxy-N,N-dimethylprop-1-en-1-amine?
ethane;(Z)-3-methoxy-N,N-dimethylprop-1-en-1-amine has a molecular weight of 145.25 g/mol, XLogP of 1.73, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;(Z)-3-methoxy-N,N-dimethylprop-1-en-1-amine is sourced from PubChem (CID 143551220), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).