C9H17NO2 — CID 154627835
(E)-N,N-diethyl-4-methoxybut-2-enamide (PubChem CID 154627835) has the molecular formula C9H17NO2 and a molecular weight of 171.24 g/mol. Its IUPAC name is (E)-N,N-diethyl-4-methoxybut-2-enamide.
| Compound Name | (E)-N,N-diethyl-4-methoxybut-2-enamide |
|---|---|
| PubChem CID | 154627835 |
| Molecular Formula | C9H17NO2 |
| Molecular Weight | 171.24 g/mol |
| Exact Mass | 171.13 |
| IUPAC Name | (E)-N,N-diethyl-4-methoxybut-2-enamide |
| SMILES | CCN(CC)C(=O)/C=C/COC |
| InChI | InChI=1S/C9H17NO2/c1-4-10(5-2)9(11)7-6-8-12-3/h6-7H,4-5,8H2,1-3H3/b7-6+ |
| InChIKey | CRRAPARYVHZRLJ-VOTSOKGWSA-N |
| XLogP | 1.06 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.24 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|