C8H15NO — CID 169217501
(3E)-N-ethyl-5-methoxypenta-1,3-dien-2-amine (PubChem CID 169217501) has the molecular formula C8H15NO and a molecular weight of 141.21 g/mol. Its IUPAC name is (3E)-N-ethyl-5-methoxypenta-1,3-dien-2-amine.
| Compound Name | (3E)-N-ethyl-5-methoxypenta-1,3-dien-2-amine |
|---|---|
| PubChem CID | 169217501 |
| Molecular Formula | C8H15NO |
| Molecular Weight | 141.21 g/mol |
| Exact Mass | 141.12 |
| IUPAC Name | (3E)-N-ethyl-5-methoxypenta-1,3-dien-2-amine |
| SMILES | C=C(/C=C/COC)NCC |
| InChI | InChI=1S/C8H15NO/c1-4-9-8(2)6-5-7-10-3/h5-6,9H,2,4,7H2,1,3H3/b6-5+ |
| InChIKey | RORLMJYSQJPUPI-AATRIKPKSA-N |
| XLogP | 1.31 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 141.21 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|