C9H15NO — CID 155697747
(3Z,4Z)-3-ethylidene-6-methoxyhexa-1,4-dien-2-amine (PubChem CID 155697747) has the molecular formula C9H15NO and a molecular weight of 153.22 g/mol. Its IUPAC name is (3Z,4Z)-3-ethylidene-6-methoxyhexa-1,4-dien-2-amine.
| Compound Name | (3Z,4Z)-3-ethylidene-6-methoxyhexa-1,4-dien-2-amine |
|---|---|
| PubChem CID | 155697747 |
| Molecular Formula | C9H15NO |
| Molecular Weight | 153.22 g/mol |
| Exact Mass | 153.12 |
| IUPAC Name | (3Z,4Z)-3-ethylidene-6-methoxyhexa-1,4-dien-2-amine |
| SMILES | C=C(N)C(/C=C\COC)=C\C |
| InChI | InChI=1S/C9H15NO/c1-4-9(8(2)10)6-5-7-11-3/h4-6H,2,7,10H2,1,3H3/b6-5-,9-4- |
| InChIKey | SQMMCVVKVUVXQO-HCJFEJOASA-N |
| XLogP | 1.61 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.22 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|