C24H28O3 — CID 173221594
1-[3-(diethoxymethyl)cyclohexa-1,3-dien-1-yl]-4-phenylmethoxybenzene (PubChem CID 173221594) has the molecular formula C24H28O3 and a molecular weight of 364.49 g/mol. Its IUPAC name is 1-[3-(diethoxymethyl)cyclohexa-1,3-dien-1-yl]-4-phenylmethoxybenzene.
| Compound Name | 1-[3-(diethoxymethyl)cyclohexa-1,3-dien-1-yl]-4-phenylmethoxybenzene |
|---|---|
| PubChem CID | 173221594 |
| Molecular Formula | C24H28O3 |
| Molecular Weight | 364.49 g/mol |
| Exact Mass | 364.20 |
| IUPAC Name | 1-[3-(diethoxymethyl)cyclohexa-1,3-dien-1-yl]-4-phenylmethoxybenzene |
| SMILES | CCOC(OCC)C1=CCCC(c2ccc(OCc3ccccc3)cc2)=C1 |
| InChI | InChI=1S/C24H28O3/c1-3-25-24(26-4-2)22-12-8-11-21(17-22)20-13-15-23(16-14-20)27-18-19-9-6-5-7-10-19/h5-7,9-10,12-17,24H,3-4,8,11,18H2,1-2H3 |
| InChIKey | DRLRZAVSPVPTFA-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.49 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|