C13H18N4 — CID 173222747
4-N-[1-(1H-imidazol-2-yl)butan-2-yl]benzene-1,4-diamine (PubChem CID 173222747) has the molecular formula C13H18N4 and a molecular weight of 230.31 g/mol. Its IUPAC name is 4-N-[1-(1H-imidazol-2-yl)butan-2-yl]benzene-1,4-diamine.
| Compound Name | 4-N-[1-(1H-imidazol-2-yl)butan-2-yl]benzene-1,4-diamine |
|---|---|
| PubChem CID | 173222747 |
| Molecular Formula | C13H18N4 |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.15 |
| IUPAC Name | 4-N-[1-(1H-imidazol-2-yl)butan-2-yl]benzene-1,4-diamine |
| SMILES | CCC(Cc1ncc[nH]1)Nc1ccc(N)cc1 |
| InChI | InChI=1S/C13H18N4/c1-2-11(9-13-15-7-8-16-13)17-12-5-3-10(14)4-6-12/h3-8,11,17H,2,9,14H2,1H3,(H,15,16) |
| InChIKey | TWJGSJDWEOFAKS-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 66.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|