About yttrium;zirconium;nitrate
yttrium;zirconium;nitrate (PubChem CID 173223635) has the molecular formula NO3YZr-
and a molecular weight of 242.13 g/mol. Its IUPAC name is yttrium;zirconium;nitrate.
Molecular Properties
| Compound Name | yttrium;zirconium;nitrate |
| PubChem CID | 173223635 |
| Molecular Formula | NO3YZr- |
| Molecular Weight | 242.13 g/mol |
| Exact Mass | 240.80 |
| IUPAC Name | yttrium;zirconium;nitrate |
| SMILES | O=[N+]([O-])[O-].[Y].[Zr] |
| InChI | InChI=1S/NO3.Y.Zr/c2-1(3)4;;/q-1;; |
| InChIKey | ZHNNVKVNKKZDDN-UHFFFAOYSA-N |
| XLogP | -0.24 |
| TPSA | 66.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.13 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze yttrium;zirconium;nitrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of yttrium;zirconium;nitrate?
The IUPAC name of yttrium;zirconium;nitrate (CID 173223635) is yttrium;zirconium;nitrate.
What is the SMILES notation for yttrium;zirconium;nitrate?
The canonical SMILES for yttrium;zirconium;nitrate is O=[N+]([O-])[O-].[Y].[Zr].
What is the InChIKey of yttrium;zirconium;nitrate?
The InChIKey is ZHNNVKVNKKZDDN-UHFFFAOYSA-N. The full InChI is InChI=1S/NO3.Y.Zr/c2-1(3)4;;/q-1;;.
What are the key properties of yttrium;zirconium;nitrate?
yttrium;zirconium;nitrate has a molecular weight of 242.13 g/mol, XLogP of -0.24, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for yttrium;zirconium;nitrate is sourced from PubChem (CID 173223635), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).