C33H33FN4O6S — CID 173224612
2-[[[5-[3-[[2-ethyl-4-(4-fluorophenyl)-5-hydroxyphenoxy]methyl]piperidine-1-carbonyl]-2-pyridinyl]hydrazinylidene]methyl]benzenesulfonic acid (PubChem CID 173224612) has the molecular formula C33H33FN4O6S and a molecular weight of 632.71 g/mol. Its IUPAC name is 2-[[[5-[3-[[2-ethyl-4-(4-fluorophenyl)-5-hydroxyphenoxy]methyl]piperidine-1-carbonyl]-2-pyridinyl]hydrazinylidene]methyl]benzenesulfonic acid.
| Compound Name | 2-[[[5-[3-[[2-ethyl-4-(4-fluorophenyl)-5-hydroxyphenoxy]methyl]piperidine-1-carbonyl]-2-pyridinyl]hydrazinylidene]methyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 173224612 |
| Molecular Formula | C33H33FN4O6S |
| Molecular Weight | 632.71 g/mol |
| Exact Mass | 632.21 |
| IUPAC Name | 2-[[[5-[3-[[2-ethyl-4-(4-fluorophenyl)-5-hydroxyphenoxy]methyl]piperidine-1-carbonyl]-2-pyridinyl]hydrazinylidene]methyl]benzenesulfonic acid |
| SMILES | CCc1cc(-c2ccc(F)cc2)c(O)cc1OCC1CCCN(C(=O)c2ccc(NN=Cc3ccccc3S(=O)(=O)O)nc2)C1 |
| InChI | InChI=1S/C33H33FN4O6S/c1-2-23-16-28(24-9-12-27(34)13-10-24)29(39)17-30(23)44-21-22-6-5-15-38(20-22)33(40)26-11-14-32(35-18-26)37-36-19-25-7-3-4-8-31(25)45(41,42)43/h3-4,7-14,16-19,22,39H,2,5-6,15,20-21H2,1H3,(H,35,37)(H,41,42,43) |
| InChIKey | UMNZCBPBCAYIFI-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 141.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.71 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|