C7H8N4O2S2 — CID 173225021
5-[(3-hydroxy-5-methyl-1,2-dihydro-1,2,4-triazol-3-yl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 173225021) has the molecular formula C7H8N4O2S2 and a molecular weight of 244.30 g/mol. Its IUPAC name is 5-[(3-hydroxy-5-methyl-1,2-dihydro-1,2,4-triazol-3-yl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | 5-[(3-hydroxy-5-methyl-1,2-dihydro-1,2,4-triazol-3-yl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 173225021 |
| Molecular Formula | C7H8N4O2S2 |
| Molecular Weight | 244.30 g/mol |
| Exact Mass | 244.01 |
| IUPAC Name | 5-[(3-hydroxy-5-methyl-1,2-dihydro-1,2,4-triazol-3-yl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | CC1=NC(O)(C=C2SC(=S)NC2=O)NN1 |
| InChI | InChI=1S/C7H8N4O2S2/c1-3-9-7(13,11-10-3)2-4-5(12)8-6(14)15-4/h2,11,13H,1H3,(H,9,10)(H,8,12,14) |
| InChIKey | XCPCIFIGUOZUIB-UHFFFAOYSA-N |
| XLogP | -0.81 |
| TPSA | 85.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.30 |
| LogP ≤ 5 | -0.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|