About 4-methoxy-3-(1-propan-2-ylpiperidin-4-yl)aniline;palladium(2+);dihydroxide
4-methoxy-3-(1-propan-2-ylpiperidin-4-yl)aniline;palladium(2+);dihydroxide (PubChem CID 173226111) has the molecular formula C15H26N2O3Pd
and a molecular weight of 388.80 g/mol. Its IUPAC name is 4-methoxy-3-(1-propan-2-ylpiperidin-4-yl)aniline;palladium(2+);dihydroxide.
Molecular Properties
| Compound Name | 4-methoxy-3-(1-propan-2-ylpiperidin-4-yl)aniline;palladium(2+);dihydroxide |
| PubChem CID | 173226111 |
| Molecular Formula | C15H26N2O3Pd |
| Molecular Weight | 388.80 g/mol |
| Exact Mass | 388.10 |
| IUPAC Name | 4-methoxy-3-(1-propan-2-ylpiperidin-4-yl)aniline;palladium(2+);dihydroxide |
| SMILES | COc1ccc(N)cc1C1CCN(C(C)C)CC1.[OH-].[OH-].[Pd+2] |
| InChI | InChI=1S/C15H24N2O.2H2O.Pd/c1-11(2)17-8-6-12(7-9-17)14-10-13(16)4-5-15(14)18-3;;;/h4-5,10-12H,6-9,16H2,1-3H3;2*1H2;/q;;;+2/p-2 |
| InChIKey | JSSNSRKZFFEPAH-UHFFFAOYSA-L |
| XLogP | 2.51 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 388.80 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-methoxy-3-(1-propan-2-ylpiperidin-4-yl)aniline;palladium(2+);dihydroxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methoxy-3-(1-propan-2-ylpiperidin-4-yl)aniline;palladium(2+);dihydroxide?
The IUPAC name of 4-methoxy-3-(1-propan-2-ylpiperidin-4-yl)aniline;palladium(2+);dihydroxide (CID 173226111) is 4-methoxy-3-(1-propan-2-ylpiperidin-4-yl)aniline;palladium(2+);dihydroxide.
What is the SMILES notation for 4-methoxy-3-(1-propan-2-ylpiperidin-4-yl)aniline;palladium(2+);dihydroxide?
The canonical SMILES for 4-methoxy-3-(1-propan-2-ylpiperidin-4-yl)aniline;palladium(2+);dihydroxide is COc1ccc(N)cc1C1CCN(C(C)C)CC1.[OH-].[OH-].[Pd+2].
What is the InChIKey of 4-methoxy-3-(1-propan-2-ylpiperidin-4-yl)aniline;palladium(2+);dihydroxide?
The InChIKey is JSSNSRKZFFEPAH-UHFFFAOYSA-L. The full InChI is InChI=1S/C15H24N2O.2H2O.Pd/c1-11(2)17-8-6-12(7-9-17)14-10-13(16)4-5-15(14)18-3;;;/h4-5,10-12H,6-9,16H2,1-3H3;2*1H2;/q;;;+2/p-2.
What are the key properties of 4-methoxy-3-(1-propan-2-ylpiperidin-4-yl)aniline;palladium(2+);dihydroxide?
4-methoxy-3-(1-propan-2-ylpiperidin-4-yl)aniline;palladium(2+);dihydroxide has a molecular weight of 388.80 g/mol, XLogP of 2.51, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methoxy-3-(1-propan-2-ylpiperidin-4-yl)aniline;palladium(2+);dihydroxide is sourced from PubChem (CID 173226111), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).