ethane-1,2-diol;5-ethyl-2-methylnon-2-enoic acid

C14H28O4 — CID 173238030

IUPACethane-1,2-diol;5-ethyl-2-methylnon-2-enoic acid
SMILESCCCCC(CC)CC=C(C)C(=O)O.OCCO
InChIInChI=1S/C12H22O2.C2H6O2/c1-4-6-7-11(5-2)9-8-10(3)12(13)14;3-1-2-4/h8,11H,4-7,9H2,1-3H3,(H,13,14);3-4H,1-2H2
InChIKeyYSFCJVRJVXNSRO-UHFFFAOYSA-N
MW260.37 g/mol
LogP2.59
Rot. Bonds8

About ethane-1,2-diol;5-ethyl-2-methylnon-2-enoic acid

ethane-1,2-diol;5-ethyl-2-methylnon-2-enoic acid (PubChem CID 173238030) has the molecular formula C14H28O4 and a molecular weight of 260.37 g/mol. Its IUPAC name is ethane-1,2-diol;5-ethyl-2-methylnon-2-enoic acid.

Molecular Properties

Compound Nameethane-1,2-diol;5-ethyl-2-methylnon-2-enoic acid
PubChem CID173238030
Molecular FormulaC14H28O4
Molecular Weight260.37 g/mol
Exact Mass260.20
IUPAC Nameethane-1,2-diol;5-ethyl-2-methylnon-2-enoic acid
SMILESCCCCC(CC)CC=C(C)C(=O)O.OCCO
InChIInChI=1S/C12H22O2.C2H6O2/c1-4-6-7-11(5-2)9-8-10(3)12(13)14;3-1-2-4/h8,11H,4-7,9H2,1-3H3,(H,13,14);3-4H,1-2H2
InChIKeyYSFCJVRJVXNSRO-UHFFFAOYSA-N
XLogP2.59
TPSA77.76 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds8
Heavy Atoms18
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500260.37
LogP ≤ 52.59
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze ethane-1,2-diol;5-ethyl-2-methylnon-2-enoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of ethane-1,2-diol;5-ethyl-2-methylnon-2-enoic acid?
The IUPAC name of ethane-1,2-diol;5-ethyl-2-methylnon-2-enoic acid (CID 173238030) is ethane-1,2-diol;5-ethyl-2-methylnon-2-enoic acid.
What is the SMILES notation for ethane-1,2-diol;5-ethyl-2-methylnon-2-enoic acid?
The canonical SMILES for ethane-1,2-diol;5-ethyl-2-methylnon-2-enoic acid is CCCCC(CC)CC=C(C)C(=O)O.OCCO.
What is the InChIKey of ethane-1,2-diol;5-ethyl-2-methylnon-2-enoic acid?
The InChIKey is YSFCJVRJVXNSRO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22O2.C2H6O2/c1-4-6-7-11(5-2)9-8-10(3)12(13)14;3-1-2-4/h8,11H,4-7,9H2,1-3H3,(H,13,14);3-4H,1-2H2.
What are the key properties of ethane-1,2-diol;5-ethyl-2-methylnon-2-enoic acid?
ethane-1,2-diol;5-ethyl-2-methylnon-2-enoic acid has a molecular weight of 260.37 g/mol, XLogP of 2.59, 8 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane-1,2-diol;5-ethyl-2-methylnon-2-enoic acid is sourced from PubChem (CID 173238030), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).