C22H21N2O6S2- — CID 173240804
N-[[3-(benzenesulfonyl)-1-hydroxy-1-oxido-2,3-dihydro-1-benzothiophen-4-yl]methyl]-1-(4-nitrophenyl)methanamine (PubChem CID 173240804) has the molecular formula C22H21N2O6S2- and a molecular weight of 473.55 g/mol. Its IUPAC name is N-[[3-(benzenesulfonyl)-1-hydroxy-1-oxido-2,3-dihydro-1-benzothiophen-4-yl]methyl]-1-(4-nitrophenyl)methanamine.
| Compound Name | N-[[3-(benzenesulfonyl)-1-hydroxy-1-oxido-2,3-dihydro-1-benzothiophen-4-yl]methyl]-1-(4-nitrophenyl)methanamine |
|---|---|
| PubChem CID | 173240804 |
| Molecular Formula | C22H21N2O6S2- |
| Molecular Weight | 473.55 g/mol |
| Exact Mass | 473.08 |
| IUPAC Name | N-[[3-(benzenesulfonyl)-1-hydroxy-1-oxido-2,3-dihydro-1-benzothiophen-4-yl]methyl]-1-(4-nitrophenyl)methanamine |
| SMILES | O=[N+]([O-])c1ccc(CNCc2cccc3c2C(S(=O)(=O)c2ccccc2)CS3([O-])O)cc1 |
| InChI | InChI=1S/C22H22N2O6S2/c25-24(26)18-11-9-16(10-12-18)13-23-14-17-5-4-8-20-22(17)21(15-31(20,27)28)32(29,30)19-6-2-1-3-7-19/h1-12,21,23,27-28H,13-15H2/p-1 |
| InChIKey | WETLEAOQDSZCTB-UHFFFAOYSA-M |
| XLogP | 4.18 |
| TPSA | 132.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.55 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|