C22H26N3O7S2- — CID 173240422
1-hydroxy-3-(4-nitrophenyl)sulfonyl-1-oxido-N-(2-piperidin-1-ylethyl)-2,3-dihydro-1-benzothiophene-4-carboxamide (PubChem CID 173240422) has the molecular formula C22H26N3O7S2- and a molecular weight of 508.60 g/mol. Its IUPAC name is 1-hydroxy-3-(4-nitrophenyl)sulfonyl-1-oxido-N-(2-piperidin-1-ylethyl)-2,3-dihydro-1-benzothiophene-4-carboxamide.
| Compound Name | 1-hydroxy-3-(4-nitrophenyl)sulfonyl-1-oxido-N-(2-piperidin-1-ylethyl)-2,3-dihydro-1-benzothiophene-4-carboxamide |
|---|---|
| PubChem CID | 173240422 |
| Molecular Formula | C22H26N3O7S2- |
| Molecular Weight | 508.60 g/mol |
| Exact Mass | 508.12 |
| IUPAC Name | 1-hydroxy-3-(4-nitrophenyl)sulfonyl-1-oxido-N-(2-piperidin-1-ylethyl)-2,3-dihydro-1-benzothiophene-4-carboxamide |
| SMILES | O=C(NCCN1CCCCC1)c1cccc2c1C(S(=O)(=O)c1ccc([N+](=O)[O-])cc1)CS2([O-])O |
| InChI | InChI=1S/C22H27N3O7S2/c26-22(23-11-14-24-12-2-1-3-13-24)18-5-4-6-19-21(18)20(15-33(19,29)30)34(31,32)17-9-7-16(8-10-17)25(27)28/h4-10,20,29-30H,1-3,11-15H2,(H,23,26)/p-1 |
| InChIKey | MEGNSMBHIRSMAP-UHFFFAOYSA-M |
| XLogP | 3.11 |
| TPSA | 152.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.60 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|